C28H26F2N2 — CID 140584992
3-(2,6-dimethylphenyl)-7-(2,2-dimethylpropyl)-6,10-difluoroimidazo[1,2-f]phenanthridine (PubChem CID 140584992) has the molecular formula C28H26F2N2 and a molecular weight of 428.53 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)-7-(2,2-dimethylpropyl)-6,10-difluoroimidazo[1,2-f]phenanthridine.
| Compound Name | 3-(2,6-dimethylphenyl)-7-(2,2-dimethylpropyl)-6,10-difluoroimidazo[1,2-f]phenanthridine |
|---|---|
| PubChem CID | 140584992 |
| Molecular Formula | C28H26F2N2 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 3-(2,6-dimethylphenyl)-7-(2,2-dimethylpropyl)-6,10-difluoroimidazo[1,2-f]phenanthridine |
| SMILES | Cc1cccc(C)c1-c1cnc2c3ccc(F)cc3c3cc(CC(C)(C)C)c(F)cc3n12 |
| InChI | InChI=1S/C28H26F2N2/c1-16-7-6-8-17(2)26(16)25-15-31-27-20-10-9-19(29)12-21(20)22-11-18(14-28(3,4)5)23(30)13-24(22)32(25)27/h6-13,15H,14H2,1-5H3 |
| InChIKey | JZYKDKLSGVLOGZ-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|