C39H52F2O14S2 — CID 140586283
[2,2-difluoro-2-[tris[4-[2-(2-methoxyethoxy)ethoxy]phenyl]-λ4-sulfanyl]oxysulfonylethyl] 2-methylprop-2-enoate (PubChem CID 140586283) has the molecular formula C39H52F2O14S2 and a molecular weight of 846.96 g/mol. Its IUPAC name is [2,2-difluoro-2-[tris[4-[2-(2-methoxyethoxy)ethoxy]phenyl]-λ4-sulfanyl]oxysulfonylethyl] 2-methylprop-2-enoate.
| Compound Name | [2,2-difluoro-2-[tris[4-[2-(2-methoxyethoxy)ethoxy]phenyl]-λ4-sulfanyl]oxysulfonylethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140586283 |
| Molecular Formula | C39H52F2O14S2 |
| Molecular Weight | 846.96 g/mol |
| Exact Mass | 846.28 |
| IUPAC Name | [2,2-difluoro-2-[tris[4-[2-(2-methoxyethoxy)ethoxy]phenyl]-λ4-sulfanyl]oxysulfonylethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(F)(F)S(=O)(=O)OS(c1ccc(OCCOCCOC)cc1)(c1ccc(OCCOCCOC)cc1)c1ccc(OCCOCCOC)cc1 |
| InChI | InChI=1S/C39H52F2O14S2/c1-31(2)38(42)54-30-39(40,41)57(43,44)55-56(35-12-6-32(7-13-35)51-27-24-48-21-18-45-3,36-14-8-33(9-15-36)52-28-25-49-22-19-46-4)37-16-10-34(11-17-37)53-29-26-50-23-20-47-5/h6-17H,1,18-30H2,2-5H3 |
| InChIKey | MFUBPYROBMNVCT-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 152.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.96 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|