C16H28O6Si — CID 140587407
(1R,4R,5R,6R,7S)-9,9-ditert-butyl-6-hydroxy-2,8,10-trioxa-9-silatricyclo[5.4.0.03,5]undecane-4-carboxylic acid (PubChem CID 140587407) has the molecular formula C16H28O6Si and a molecular weight of 344.48 g/mol. Its IUPAC name is (1R,4R,5R,6R,7S)-9,9-ditert-butyl-6-hydroxy-2,8,10-trioxa-9-silatricyclo[5.4.0.03,5]undecane-4-carboxylic acid.
| Compound Name | (1R,4R,5R,6R,7S)-9,9-ditert-butyl-6-hydroxy-2,8,10-trioxa-9-silatricyclo[5.4.0.03,5]undecane-4-carboxylic acid |
|---|---|
| PubChem CID | 140587407 |
| Molecular Formula | C16H28O6Si |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (1R,4R,5R,6R,7S)-9,9-ditert-butyl-6-hydroxy-2,8,10-trioxa-9-silatricyclo[5.4.0.03,5]undecane-4-carboxylic acid |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)OC[C@H]2OC3[C@@H]([C@@H](O)[C@@H]2O1)[C@H]3C(=O)O |
| InChI | InChI=1S/C16H28O6Si/c1-15(2,3)23(16(4,5)6)20-7-8-12(22-23)11(17)9-10(14(18)19)13(9)21-8/h8-13,17H,7H2,1-6H3,(H,18,19)/t8-,9-,10-,11-,12-,13?/m1/s1 |
| InChIKey | RVVCMHDFWHNGMF-FDUWWSHESA-N |
| XLogP | 1.90 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|