C23H24F4N2O4 — CID 140590439
N-[(2,4-dimethoxyphenyl)methyl]-4-(2-fluorophenyl)-4-methyl-7a-(trifluoromethyl)-3,4a,5,7-tetrahydrofuro[3,4-e][1,3]oxazin-2-imine (PubChem CID 140590439) has the molecular formula C23H24F4N2O4 and a molecular weight of 468.45 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-4-(2-fluorophenyl)-4-methyl-7a-(trifluoromethyl)-3,4a,5,7-tetrahydrofuro[3,4-e][1,3]oxazin-2-imine.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-4-(2-fluorophenyl)-4-methyl-7a-(trifluoromethyl)-3,4a,5,7-tetrahydrofuro[3,4-e][1,3]oxazin-2-imine |
|---|---|
| PubChem CID | 140590439 |
| Molecular Formula | C23H24F4N2O4 |
| Molecular Weight | 468.45 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-4-(2-fluorophenyl)-4-methyl-7a-(trifluoromethyl)-3,4a,5,7-tetrahydrofuro[3,4-e][1,3]oxazin-2-imine |
| SMILES | COc1ccc(C/N=C2/NC(C)(c3ccccc3F)C3COCC3(C(F)(F)F)O2)c(OC)c1 |
| InChI | InChI=1S/C23H24F4N2O4/c1-21(16-6-4-5-7-17(16)24)19-12-32-13-22(19,23(25,26)27)33-20(29-21)28-11-14-8-9-15(30-2)10-18(14)31-3/h4-10,19H,11-13H2,1-3H3,(H,28,29) |
| InChIKey | PATCGAMBZCLLSP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 61.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|