C23H23FN2O4 — CID 135928909
3-[4-[(2,4-dimethoxyphenyl)methylimino]-5,5-dimethylfuran-2-yl]-6-fluoro-1H-indol-2-ol (PubChem CID 135928909) has the molecular formula C23H23FN2O4 and a molecular weight of 410.45 g/mol. Its IUPAC name is 3-[4-[(2,4-dimethoxyphenyl)methylimino]-5,5-dimethylfuran-2-yl]-6-fluoro-1H-indol-2-ol.
| Compound Name | 3-[4-[(2,4-dimethoxyphenyl)methylimino]-5,5-dimethylfuran-2-yl]-6-fluoro-1H-indol-2-ol |
|---|---|
| PubChem CID | 135928909 |
| Molecular Formula | C23H23FN2O4 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 3-[4-[(2,4-dimethoxyphenyl)methylimino]-5,5-dimethylfuran-2-yl]-6-fluoro-1H-indol-2-ol |
| SMILES | COc1ccc(C/N=C2\C=C(c3c(O)[nH]c4cc(F)ccc34)OC2(C)C)c(OC)c1 |
| InChI | InChI=1S/C23H23FN2O4/c1-23(2)20(25-12-13-5-7-15(28-3)10-18(13)29-4)11-19(30-23)21-16-8-6-14(24)9-17(16)26-22(21)27/h5-11,26-27H,12H2,1-4H3/b25-20+ |
| InChIKey | GHEYCMDGSUTADG-LKUDQCMESA-N |
| XLogP | 4.82 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|