C17H14F3N3O3 — CID 140590675
6-[(2,3,4-trifluorophenyl)carbamoylamino]-3,4-dihydro-1H-isoquinoline-2-carboxylic acid (PubChem CID 140590675) has the molecular formula C17H14F3N3O3 and a molecular weight of 365.31 g/mol. Its IUPAC name is 6-[(2,3,4-trifluorophenyl)carbamoylamino]-3,4-dihydro-1H-isoquinoline-2-carboxylic acid.
| Compound Name | 6-[(2,3,4-trifluorophenyl)carbamoylamino]-3,4-dihydro-1H-isoquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 140590675 |
| Molecular Formula | C17H14F3N3O3 |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 6-[(2,3,4-trifluorophenyl)carbamoylamino]-3,4-dihydro-1H-isoquinoline-2-carboxylic acid |
| SMILES | O=C(Nc1ccc2c(c1)CCN(C(=O)O)C2)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H14F3N3O3/c18-12-3-4-13(15(20)14(12)19)22-16(24)21-11-2-1-10-8-23(17(25)26)6-5-9(10)7-11/h1-4,7H,5-6,8H2,(H,25,26)(H2,21,22,24) |
| InChIKey | XMSRECIXVHNULW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|