C17H14F3N3O2 — CID 173032990
1-(2-formyl-3,4-dihydro-1H-isoquinolin-6-yl)-3-(2,4,5-trifluorophenyl)urea (PubChem CID 173032990) has the molecular formula C17H14F3N3O2 and a molecular weight of 349.31 g/mol. Its IUPAC name is 1-(2-formyl-3,4-dihydro-1H-isoquinolin-6-yl)-3-(2,4,5-trifluorophenyl)urea.
| Compound Name | 1-(2-formyl-3,4-dihydro-1H-isoquinolin-6-yl)-3-(2,4,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 173032990 |
| Molecular Formula | C17H14F3N3O2 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 1-(2-formyl-3,4-dihydro-1H-isoquinolin-6-yl)-3-(2,4,5-trifluorophenyl)urea |
| SMILES | O=CN1CCc2cc(NC(=O)Nc3cc(F)c(F)cc3F)ccc2C1 |
| InChI | InChI=1S/C17H14F3N3O2/c18-13-6-15(20)16(7-14(13)19)22-17(25)21-12-2-1-11-8-23(9-24)4-3-10(11)5-12/h1-2,5-7,9H,3-4,8H2,(H2,21,22,25) |
| InChIKey | JNAYPJDDAFAHPQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|