C23H30IN3OS — CID 140598385
7-(2,6-dimethylmorpholin-4-yl)-1-ethyl-5-iodo-N,N,9-trimethylphenothiazin-3-amine (PubChem CID 140598385) has the molecular formula C23H30IN3OS and a molecular weight of 523.48 g/mol. Its IUPAC name is 7-(2,6-dimethylmorpholin-4-yl)-1-ethyl-5-iodo-N,N,9-trimethylphenothiazin-3-amine.
| Compound Name | 7-(2,6-dimethylmorpholin-4-yl)-1-ethyl-5-iodo-N,N,9-trimethylphenothiazin-3-amine |
|---|---|
| PubChem CID | 140598385 |
| Molecular Formula | C23H30IN3OS |
| Molecular Weight | 523.48 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | 7-(2,6-dimethylmorpholin-4-yl)-1-ethyl-5-iodo-N,N,9-trimethylphenothiazin-3-amine |
| SMILES | CCc1cc(N(C)C)cc2c1N=c1c(C)cc(N3CC(C)OC(C)C3)cc1=S2I |
| InChI | InChI=1S/C23H30IN3OS/c1-7-17-9-18(26(5)6)10-21-23(17)25-22-14(2)8-19(11-20(22)29(21)24)27-12-15(3)28-16(4)13-27/h8-11,15-16H,7,12-13H2,1-6H3 |
| InChIKey | APIACSMZRNXLGJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.48 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|