C28H58N4O2 — CID 140600210
1,4-bis(3-aminopropylamino)butyl (Z)-octadec-9-enoate (PubChem CID 140600210) has the molecular formula C28H58N4O2 and a molecular weight of 482.80 g/mol. Its IUPAC name is 1,4-bis(3-aminopropylamino)butyl (Z)-octadec-9-enoate.
| Compound Name | 1,4-bis(3-aminopropylamino)butyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 140600210 |
| Molecular Formula | C28H58N4O2 |
| Molecular Weight | 482.80 g/mol |
| Exact Mass | 482.46 |
| IUPAC Name | 1,4-bis(3-aminopropylamino)butyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC(CCCNCCCN)NCCCN |
| InChI | InChI=1S/C28H58N4O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-21-28(33)34-27(32-26-19-23-30)20-17-24-31-25-18-22-29/h9-10,27,31-32H,2-8,11-26,29-30H2,1H3/b10-9- |
| InChIKey | VJSZEQFEWDBIPJ-KTKRTIGZSA-N |
| XLogP | 5.55 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.80 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|