C41H38F3O2S2+ — CID 140600605
[4-(9,10-dibutoxyanthracen-2-yl)sulfanylphenyl]-phenyl-[4-(trifluoromethyl)phenyl]sulfanium (PubChem CID 140600605) has the molecular formula C41H38F3O2S2+ and a molecular weight of 683.88 g/mol. Its IUPAC name is [4-(9,10-dibutoxyanthracen-2-yl)sulfanylphenyl]-phenyl-[4-(trifluoromethyl)phenyl]sulfanium.
| Compound Name | [4-(9,10-dibutoxyanthracen-2-yl)sulfanylphenyl]-phenyl-[4-(trifluoromethyl)phenyl]sulfanium |
|---|---|
| PubChem CID | 140600605 |
| Molecular Formula | C41H38F3O2S2+ |
| Molecular Weight | 683.88 g/mol |
| Exact Mass | 683.23 |
| IUPAC Name | [4-(9,10-dibutoxyanthracen-2-yl)sulfanylphenyl]-phenyl-[4-(trifluoromethyl)phenyl]sulfanium |
| SMILES | CCCCOc1c2ccccc2c(OCCCC)c2cc(Sc3ccc([S+](c4ccccc4)c4ccc(C(F)(F)F)cc4)cc3)ccc12 |
| InChI | InChI=1S/C41H38F3O2S2/c1-3-5-26-45-39-35-14-10-11-15-36(35)40(46-27-6-4-2)38-28-31(20-25-37(38)39)47-30-18-23-34(24-19-30)48(32-12-8-7-9-13-32)33-21-16-29(17-22-33)41(42,43)44/h7-25,28H,3-6,26-27H2,1-2H3/q+1 |
| InChIKey | PBRQICMJSGRSIM-UHFFFAOYSA-N |
| XLogP | 12.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.88 |
| LogP ≤ 5 | 12.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|