C26H22F4N4 — CID 140602566
3-[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]hexan-2-yl]-2-pyridinyl]-2,6-difluoropyridine (PubChem CID 140602566) has the molecular formula C26H22F4N4 and a molecular weight of 466.48 g/mol. Its IUPAC name is 3-[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]hexan-2-yl]-2-pyridinyl]-2,6-difluoropyridine.
| Compound Name | 3-[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]hexan-2-yl]-2-pyridinyl]-2,6-difluoropyridine |
|---|---|
| PubChem CID | 140602566 |
| Molecular Formula | C26H22F4N4 |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 3-[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]hexan-2-yl]-2-pyridinyl]-2,6-difluoropyridine |
| SMILES | CCCCC(C)(c1cccc(-c2ccc(F)nc2F)n1)c1cccc(-c2ccc(F)nc2F)n1 |
| InChI | InChI=1S/C26H22F4N4/c1-3-4-15-26(2,20-9-5-7-18(31-20)16-11-13-22(27)33-24(16)29)21-10-6-8-19(32-21)17-12-14-23(28)34-25(17)30/h5-14H,3-4,15H2,1-2H3 |
| InChIKey | OTVQJJMAURBDGO-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|