C35H24Cl2F2N4 — CID 159002978
2-(2,6-dichloro-3-pyridinyl)-6-[2-[6-(2,6-difluoro-3-pyridinyl)-4-phenyl-2-pyridinyl]propan-2-yl]-4-phenylpyridine (PubChem CID 159002978) has the molecular formula C35H24Cl2F2N4 and a molecular weight of 609.51 g/mol. Its IUPAC name is 2-(2,6-dichloro-3-pyridinyl)-6-[2-[6-(2,6-difluoro-3-pyridinyl)-4-phenyl-2-pyridinyl]propan-2-yl]-4-phenylpyridine.
| Compound Name | 2-(2,6-dichloro-3-pyridinyl)-6-[2-[6-(2,6-difluoro-3-pyridinyl)-4-phenyl-2-pyridinyl]propan-2-yl]-4-phenylpyridine |
|---|---|
| PubChem CID | 159002978 |
| Molecular Formula | C35H24Cl2F2N4 |
| Molecular Weight | 609.51 g/mol |
| Exact Mass | 608.13 |
| IUPAC Name | 2-(2,6-dichloro-3-pyridinyl)-6-[2-[6-(2,6-difluoro-3-pyridinyl)-4-phenyl-2-pyridinyl]propan-2-yl]-4-phenylpyridine |
| SMILES | CC(C)(c1cc(-c2ccccc2)cc(-c2ccc(F)nc2F)n1)c1cc(-c2ccccc2)cc(-c2ccc(Cl)nc2Cl)n1 |
| InChI | InChI=1S/C35H24Cl2F2N4/c1-35(2,29-19-23(21-9-5-3-6-10-21)17-27(40-29)25-13-15-31(36)42-33(25)37)30-20-24(22-11-7-4-8-12-22)18-28(41-30)26-14-16-32(38)43-34(26)39/h3-20H,1-2H3 |
| InChIKey | MLRQGQKHRNHBCL-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.51 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|