C19H21N5O4 — CID 140608387
3-N-(3-aminopropyl)-1-N-[5-(furan-2-yl)-1-methylpyrazol-3-yl]-4-hydroxybenzene-1,3-dicarboxamide (PubChem CID 140608387) has the molecular formula C19H21N5O4 and a molecular weight of 383.41 g/mol. Its IUPAC name is 3-N-(3-aminopropyl)-1-N-[5-(furan-2-yl)-1-methylpyrazol-3-yl]-4-hydroxybenzene-1,3-dicarboxamide.
| Compound Name | 3-N-(3-aminopropyl)-1-N-[5-(furan-2-yl)-1-methylpyrazol-3-yl]-4-hydroxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 140608387 |
| Molecular Formula | C19H21N5O4 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 3-N-(3-aminopropyl)-1-N-[5-(furan-2-yl)-1-methylpyrazol-3-yl]-4-hydroxybenzene-1,3-dicarboxamide |
| SMILES | Cn1nc(NC(=O)c2ccc(O)c(C(=O)NCCCN)c2)cc1-c1ccco1 |
| InChI | InChI=1S/C19H21N5O4/c1-24-14(16-4-2-9-28-16)11-17(23-24)22-18(26)12-5-6-15(25)13(10-12)19(27)21-8-3-7-20/h2,4-6,9-11,25H,3,7-8,20H2,1H3,(H,21,27)(H,22,23,26) |
| InChIKey | PEFGLVSAMHZRGM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 135.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|