C19H21N5O3 — CID 140608395
3-N-(3-aminopropyl)-1-N-(1H-indazol-3-yl)-4-methoxybenzene-1,3-dicarboxamide (PubChem CID 140608395) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is 3-N-(3-aminopropyl)-1-N-(1H-indazol-3-yl)-4-methoxybenzene-1,3-dicarboxamide.
| Compound Name | 3-N-(3-aminopropyl)-1-N-(1H-indazol-3-yl)-4-methoxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 140608395 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 3-N-(3-aminopropyl)-1-N-(1H-indazol-3-yl)-4-methoxybenzene-1,3-dicarboxamide |
| SMILES | COc1ccc(C(=O)Nc2n[nH]c3ccccc23)cc1C(=O)NCCCN |
| InChI | InChI=1S/C19H21N5O3/c1-27-16-8-7-12(11-14(16)19(26)21-10-4-9-20)18(25)22-17-13-5-2-3-6-15(13)23-24-17/h2-3,5-8,11H,4,9-10,20H2,1H3,(H,21,26)(H2,22,23,24,25) |
| InChIKey | MYFFBVVPXGVTPU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|