C22H24ClN5O3 — CID 66727961
N-[3-(3-aminopropylcarbamoyl)-4-methoxyphenyl]-3-(3-chlorophenyl)-4-methyl-1H-pyrazole-5-carboxamide (PubChem CID 66727961) has the molecular formula C22H24ClN5O3 and a molecular weight of 441.92 g/mol. Its IUPAC name is N-[3-(3-aminopropylcarbamoyl)-4-methoxyphenyl]-3-(3-chlorophenyl)-4-methyl-1H-pyrazole-5-carboxamide.
| Compound Name | N-[3-(3-aminopropylcarbamoyl)-4-methoxyphenyl]-3-(3-chlorophenyl)-4-methyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 66727961 |
| Molecular Formula | C22H24ClN5O3 |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | N-[3-(3-aminopropylcarbamoyl)-4-methoxyphenyl]-3-(3-chlorophenyl)-4-methyl-1H-pyrazole-5-carboxamide |
| SMILES | COc1ccc(NC(=O)c2[nH]nc(-c3cccc(Cl)c3)c2C)cc1C(=O)NCCCN |
| InChI | InChI=1S/C22H24ClN5O3/c1-13-19(14-5-3-6-15(23)11-14)27-28-20(13)22(30)26-16-7-8-18(31-2)17(12-16)21(29)25-10-4-9-24/h3,5-8,11-12H,4,9-10,24H2,1-2H3,(H,25,29)(H,26,30)(H,27,28) |
| InChIKey | HIRAGVIBNDGDSE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|