C21H24N4O3 — CID 66728085
N-[3-(3-aminopropylcarbamoyl)-4-methoxyphenyl]-2-methyl-1H-indole-3-carboxamide (PubChem CID 66728085) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-[3-(3-aminopropylcarbamoyl)-4-methoxyphenyl]-2-methyl-1H-indole-3-carboxamide.
| Compound Name | N-[3-(3-aminopropylcarbamoyl)-4-methoxyphenyl]-2-methyl-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 66728085 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N-[3-(3-aminopropylcarbamoyl)-4-methoxyphenyl]-2-methyl-1H-indole-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2c(C)[nH]c3ccccc23)cc1C(=O)NCCCN |
| InChI | InChI=1S/C21H24N4O3/c1-13-19(15-6-3-4-7-17(15)24-13)21(27)25-14-8-9-18(28-2)16(12-14)20(26)23-11-5-10-22/h3-4,6-9,12,24H,5,10-11,22H2,1-2H3,(H,23,26)(H,25,27) |
| InChIKey | UAOKHIDRPPQKAV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 109.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|