About N-(3-aminopropyl)-5-(1,3-benzodioxol-5-ylcarbamoylamino)-2-methoxybenzamide
N-(3-aminopropyl)-5-(1,3-benzodioxol-5-ylcarbamoylamino)-2-methoxybenzamide (PubChem CID 66748308) has the molecular formula C19H22N4O5
and a molecular weight of 386.41 g/mol. Its IUPAC name is N-(3-aminopropyl)-5-(1,3-benzodioxol-5-ylcarbamoylamino)-2-methoxybenzamide.
Molecular Properties
| Compound Name | N-(3-aminopropyl)-5-(1,3-benzodioxol-5-ylcarbamoylamino)-2-methoxybenzamide |
| PubChem CID | 66748308 |
| Molecular Formula | C19H22N4O5 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | N-(3-aminopropyl)-5-(1,3-benzodioxol-5-ylcarbamoylamino)-2-methoxybenzamide |
| SMILES | COc1ccc(NC(=O)Nc2ccc3c(c2)OCO3)cc1C(=O)NCCCN |
| InChI | InChI=1S/C19H22N4O5/c1-26-15-5-3-12(9-14(15)18(24)21-8-2-7-20)22-19(25)23-13-4-6-16-17(10-13)28-11-27-16/h3-6,9-10H,2,7-8,11,20H2,1H3,(H,21,24)(H2,22,23,25) |
| InChIKey | VXKYSIFNXYPDQK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-aminopropyl)-5-(1,3-benzodioxol-5-ylcarbamoylamino)-2-methoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-aminopropyl)-5-(1,3-benzodioxol-5-ylcarbamoylamino)-2-methoxybenzamide?
The IUPAC name of N-(3-aminopropyl)-5-(1,3-benzodioxol-5-ylcarbamoylamino)-2-methoxybenzamide (CID 66748308) is N-(3-aminopropyl)-5-(1,3-benzodioxol-5-ylcarbamoylamino)-2-methoxybenzamide.
What is the SMILES notation for N-(3-aminopropyl)-5-(1,3-benzodioxol-5-ylcarbamoylamino)-2-methoxybenzamide?
The canonical SMILES for N-(3-aminopropyl)-5-(1,3-benzodioxol-5-ylcarbamoylamino)-2-methoxybenzamide is COc1ccc(NC(=O)Nc2ccc3c(c2)OCO3)cc1C(=O)NCCCN.
What is the InChIKey of N-(3-aminopropyl)-5-(1,3-benzodioxol-5-ylcarbamoylamino)-2-methoxybenzamide?
The InChIKey is VXKYSIFNXYPDQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O5/c1-26-15-5-3-12(9-14(15)18(24)21-8-2-7-20)22-19(25)23-13-4-6-16-17(10-13)28-11-27-16/h3-6,9-10H,2,7-8,11,20H2,1H3,(H,21,24)(H2,22,23,25).
What are the key properties of N-(3-aminopropyl)-5-(1,3-benzodioxol-5-ylcarbamoylamino)-2-methoxybenzamide?
N-(3-aminopropyl)-5-(1,3-benzodioxol-5-ylcarbamoylamino)-2-methoxybenzamide has a molecular weight of 386.41 g/mol, XLogP of 2.15, 7 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-aminopropyl)-5-(1,3-benzodioxol-5-ylcarbamoylamino)-2-methoxybenzamide is sourced from PubChem (CID 66748308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).