C13H23O4S- — CID 140609015
4-hydroxy-4-oxo-3-(3,4,5-trimethylhexylsulfanyl)butanoate (PubChem CID 140609015) has the molecular formula C13H23O4S- and a molecular weight of 275.39 g/mol. Its IUPAC name is 4-hydroxy-4-oxo-3-(3,4,5-trimethylhexylsulfanyl)butanoate.
| Compound Name | 4-hydroxy-4-oxo-3-(3,4,5-trimethylhexylsulfanyl)butanoate |
|---|---|
| PubChem CID | 140609015 |
| Molecular Formula | C13H23O4S- |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 4-hydroxy-4-oxo-3-(3,4,5-trimethylhexylsulfanyl)butanoate |
| SMILES | CC(C)C(C)C(C)CCSC(CC(=O)[O-])C(=O)O |
| InChI | InChI=1S/C13H24O4S/c1-8(2)10(4)9(3)5-6-18-11(13(16)17)7-12(14)15/h8-11H,5-7H2,1-4H3,(H,14,15)(H,16,17)/p-1 |
| InChIKey | ACBDXRXCHYADSG-UHFFFAOYSA-M |
| XLogP | 1.63 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |