C33H39IrN2O2- — CID 140610524
2-(3,5-dimethylbenzene-6-id-1-yl)-5-(2,6-dimethylphenyl)-3-(3,5-dimethylphenyl)pyrazine;iridium;pentane-2,4-diol (PubChem CID 140610524) has the molecular formula C33H39IrN2O2- and a molecular weight of 687.90 g/mol. Its IUPAC name is 2-(3,5-dimethylbenzene-6-id-1-yl)-5-(2,6-dimethylphenyl)-3-(3,5-dimethylphenyl)pyrazine;iridium;pentane-2,4-diol.
| Compound Name | 2-(3,5-dimethylbenzene-6-id-1-yl)-5-(2,6-dimethylphenyl)-3-(3,5-dimethylphenyl)pyrazine;iridium;pentane-2,4-diol |
|---|---|
| PubChem CID | 140610524 |
| Molecular Formula | C33H39IrN2O2- |
| Molecular Weight | 687.90 g/mol |
| Exact Mass | 688.26 |
| IUPAC Name | 2-(3,5-dimethylbenzene-6-id-1-yl)-5-(2,6-dimethylphenyl)-3-(3,5-dimethylphenyl)pyrazine;iridium;pentane-2,4-diol |
| SMILES | CC(O)CC(C)O.Cc1[c-]c(-c2ncc(-c3c(C)cccc3C)nc2-c2cc(C)cc(C)c2)cc(C)c1.[Ir] |
| InChI | InChI=1S/C28H27N2.C5H12O2.Ir/c1-17-10-18(2)13-23(12-17)27-28(24-14-19(3)11-20(4)15-24)30-25(16-29-27)26-21(5)8-7-9-22(26)6;1-4(6)3-5(2)7;/h7-12,14-16H,1-6H3;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | TWFZLACKOYIXMB-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.90 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|