C37H40IrN3O2- — CID 162454780
2-(3,5-dimethylbenzene-6-id-1-yl)-3-(3,5-dimethylphenyl)-5-(5-isocyano-2-methylphenyl)pyrazine;(Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium (PubChem CID 162454780) has the molecular formula C37H40IrN3O2- and a molecular weight of 750.96 g/mol. Its IUPAC name is 2-(3,5-dimethylbenzene-6-id-1-yl)-3-(3,5-dimethylphenyl)-5-(5-isocyano-2-methylphenyl)pyrazine;(Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium.
| Compound Name | 2-(3,5-dimethylbenzene-6-id-1-yl)-3-(3,5-dimethylphenyl)-5-(5-isocyano-2-methylphenyl)pyrazine;(Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium |
|---|---|
| PubChem CID | 162454780 |
| Molecular Formula | C37H40IrN3O2- |
| Molecular Weight | 750.96 g/mol |
| Exact Mass | 751.28 |
| IUPAC Name | 2-(3,5-dimethylbenzene-6-id-1-yl)-3-(3,5-dimethylphenyl)-5-(5-isocyano-2-methylphenyl)pyrazine;(Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium |
| SMILES | CC(C)C(=O)/C=C(\O)C(C)C.[C-]#[N+]c1ccc(C)c(-c2cnc(-c3[c-]c(C)cc(C)c3)c(-c3cc(C)cc(C)c3)n2)c1.[Ir] |
| InChI | InChI=1S/C28H24N3.C9H16O2.Ir/c1-17-9-18(2)12-22(11-17)27-28(23-13-19(3)10-20(4)14-23)31-26(16-30-27)25-15-24(29-6)8-7-21(25)5;1-6(2)8(10)5-9(11)7(3)4;/h7-11,13-16H,1-5H3;5-7,10H,1-4H3;/q-1;;/b;8-5-; |
| InChIKey | KCFVCQQGFDTBLZ-QBBOVCHSSA-N |
| XLogP | 9.68 |
| TPSA | 67.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.96 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|