C16H12N2S2Se — CID 140616520
4,7-bis(5-methylthiophen-2-yl)-2,1,3-benzoselenadiazole (PubChem CID 140616520) has the molecular formula C16H12N2S2Se and a molecular weight of 375.38 g/mol. Its IUPAC name is 4,7-bis(5-methylthiophen-2-yl)-2,1,3-benzoselenadiazole.
| Compound Name | 4,7-bis(5-methylthiophen-2-yl)-2,1,3-benzoselenadiazole |
|---|---|
| PubChem CID | 140616520 |
| Molecular Formula | C16H12N2S2Se |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.96 |
| IUPAC Name | 4,7-bis(5-methylthiophen-2-yl)-2,1,3-benzoselenadiazole |
| SMILES | Cc1ccc(-c2ccc(-c3ccc(C)s3)c3n[se]nc23)s1 |
| InChI | InChI=1S/C16H12N2S2Se/c1-9-3-7-13(19-9)11-5-6-12(14-8-4-10(2)20-14)16-15(11)17-21-18-16/h3-8H,1-2H3 |
| InChIKey | XOUSMNIAYXFBOW-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|