C9H18ClN3O — CID 140617900
1-chloro-1-(2-isocyanoethoxy)-2,2-di(propan-2-yl)hydrazine (PubChem CID 140617900) has the molecular formula C9H18ClN3O and a molecular weight of 219.72 g/mol. Its IUPAC name is 1-chloro-1-(2-isocyanoethoxy)-2,2-di(propan-2-yl)hydrazine.
| Compound Name | 1-chloro-1-(2-isocyanoethoxy)-2,2-di(propan-2-yl)hydrazine |
|---|---|
| PubChem CID | 140617900 |
| Molecular Formula | C9H18ClN3O |
| Molecular Weight | 219.72 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 1-chloro-1-(2-isocyanoethoxy)-2,2-di(propan-2-yl)hydrazine |
| SMILES | [C-]#[N+]CCON(Cl)N(C(C)C)C(C)C |
| InChI | InChI=1S/C9H18ClN3O/c1-8(2)12(9(3)4)13(10)14-7-6-11-5/h8-9H,6-7H2,1-4H3 |
| InChIKey | OHJMOEGWJHXPQS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 20.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.72 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|