About chloro-(2-isocyanoethoxy)-methylphosphane;2-isocyanoethoxy(dimethyl)phosphane
chloro-(2-isocyanoethoxy)-methylphosphane;2-isocyanoethoxy(dimethyl)phosphane (PubChem CID 163663485) has the molecular formula C9H17ClN2O2P2
and a molecular weight of 282.65 g/mol. Its IUPAC name is chloro-(2-isocyanoethoxy)-methylphosphane;2-isocyanoethoxy(dimethyl)phosphane.
Molecular Properties
| Compound Name | chloro-(2-isocyanoethoxy)-methylphosphane;2-isocyanoethoxy(dimethyl)phosphane |
| PubChem CID | 163663485 |
| Molecular Formula | C9H17ClN2O2P2 |
| Molecular Weight | 282.65 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | chloro-(2-isocyanoethoxy)-methylphosphane;2-isocyanoethoxy(dimethyl)phosphane |
| SMILES | [C-]#[N+]CCOP(C)C.[C-]#[N+]CCOP(C)Cl |
| InChI | InChI=1S/C5H10NOP.C4H7ClNOP/c1-6-4-5-7-8(2)3;1-6-3-4-7-8(2)5/h4-5H2,2-3H3;3-4H2,2H3 |
| InChIKey | IWJDWBUIOAQJHV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 27.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.65 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chloro-(2-isocyanoethoxy)-methylphosphane;2-isocyanoethoxy(dimethyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-(2-isocyanoethoxy)-methylphosphane;2-isocyanoethoxy(dimethyl)phosphane?
The IUPAC name of chloro-(2-isocyanoethoxy)-methylphosphane;2-isocyanoethoxy(dimethyl)phosphane (CID 163663485) is chloro-(2-isocyanoethoxy)-methylphosphane;2-isocyanoethoxy(dimethyl)phosphane.
What is the SMILES notation for chloro-(2-isocyanoethoxy)-methylphosphane;2-isocyanoethoxy(dimethyl)phosphane?
The canonical SMILES for chloro-(2-isocyanoethoxy)-methylphosphane;2-isocyanoethoxy(dimethyl)phosphane is [C-]#[N+]CCOP(C)C.[C-]#[N+]CCOP(C)Cl.
What is the InChIKey of chloro-(2-isocyanoethoxy)-methylphosphane;2-isocyanoethoxy(dimethyl)phosphane?
The InChIKey is IWJDWBUIOAQJHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10NOP.C4H7ClNOP/c1-6-4-5-7-8(2)3;1-6-3-4-7-8(2)5/h4-5H2,2-3H3;3-4H2,2H3.
What are the key properties of chloro-(2-isocyanoethoxy)-methylphosphane;2-isocyanoethoxy(dimethyl)phosphane?
chloro-(2-isocyanoethoxy)-methylphosphane;2-isocyanoethoxy(dimethyl)phosphane has a molecular weight of 282.65 g/mol, XLogP of 3.68, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-(2-isocyanoethoxy)-methylphosphane;2-isocyanoethoxy(dimethyl)phosphane is sourced from PubChem (CID 163663485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).