C15H11F6OP — CID 140618175
[3,5-bis(trifluoromethyl)phenyl]-(2-methoxyphenyl)phosphane (PubChem CID 140618175) has the molecular formula C15H11F6OP and a molecular weight of 352.21 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-(2-methoxyphenyl)phosphane.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-(2-methoxyphenyl)phosphane |
|---|---|
| PubChem CID | 140618175 |
| Molecular Formula | C15H11F6OP |
| Molecular Weight | 352.21 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-(2-methoxyphenyl)phosphane |
| SMILES | COc1ccccc1Pc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H11F6OP/c1-22-12-4-2-3-5-13(12)23-11-7-9(14(16,17)18)6-10(8-11)15(19,20)21/h2-8,23H,1H3 |
| InChIKey | HCDUXAVZUFDDDB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.21 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|