C15H17OP — CID 174776553
(2,3-dimethylphenyl)-(2-methoxyphenyl)phosphane (PubChem CID 174776553) has the molecular formula C15H17OP and a molecular weight of 244.27 g/mol. Its IUPAC name is (2,3-dimethylphenyl)-(2-methoxyphenyl)phosphane.
| Compound Name | (2,3-dimethylphenyl)-(2-methoxyphenyl)phosphane |
|---|---|
| PubChem CID | 174776553 |
| Molecular Formula | C15H17OP |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | (2,3-dimethylphenyl)-(2-methoxyphenyl)phosphane |
| SMILES | COc1ccccc1Pc1cccc(C)c1C |
| InChI | InChI=1S/C15H17OP/c1-11-7-6-10-14(12(11)2)17-15-9-5-4-8-13(15)16-3/h4-10,17H,1-3H3 |
| InChIKey | HICVWPJETIMUNS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|