C10H15OP — CID 69053238
(2,3-dimethylphenyl)-ethoxyphosphane (PubChem CID 69053238) has the molecular formula C10H15OP and a molecular weight of 182.20 g/mol. Its IUPAC name is (2,3-dimethylphenyl)-ethoxyphosphane.
| Compound Name | (2,3-dimethylphenyl)-ethoxyphosphane |
|---|---|
| PubChem CID | 69053238 |
| Molecular Formula | C10H15OP |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (2,3-dimethylphenyl)-ethoxyphosphane |
| SMILES | CCOPc1cccc(C)c1C |
| InChI | InChI=1S/C10H15OP/c1-4-11-12-10-7-5-6-8(2)9(10)3/h5-7,12H,4H2,1-3H3 |
| InChIKey | JKBBKSIDZJTUFW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|