C17H11F7O — CID 148884492
1-[(E)-1-fluoro-2-(2-methoxyphenyl)ethenyl]-3,5-bis(trifluoromethyl)benzene (PubChem CID 148884492) has the molecular formula C17H11F7O and a molecular weight of 364.26 g/mol. Its IUPAC name is 1-[(E)-1-fluoro-2-(2-methoxyphenyl)ethenyl]-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-[(E)-1-fluoro-2-(2-methoxyphenyl)ethenyl]-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 148884492 |
| Molecular Formula | C17H11F7O |
| Molecular Weight | 364.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 1-[(E)-1-fluoro-2-(2-methoxyphenyl)ethenyl]-3,5-bis(trifluoromethyl)benzene |
| SMILES | COc1ccccc1/C=C(/F)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H11F7O/c1-25-15-5-3-2-4-10(15)8-14(18)11-6-12(16(19,20)21)9-13(7-11)17(22,23)24/h2-9H,1H3/b14-8+ |
| InChIKey | PDSHIXOMWUNLPA-RIYZIHGNSA-N |
| XLogP | 6.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.26 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|