C18H19N3O4Se — CID 140618612
methyl 4-[[6,7-bis(hydroxymethyl)-2-methylquinazolin-4-yl]amino]-5-methylselenophene-2-carboxylate (PubChem CID 140618612) has the molecular formula C18H19N3O4Se and a molecular weight of 420.33 g/mol. Its IUPAC name is methyl 4-[[6,7-bis(hydroxymethyl)-2-methylquinazolin-4-yl]amino]-5-methylselenophene-2-carboxylate.
| Compound Name | methyl 4-[[6,7-bis(hydroxymethyl)-2-methylquinazolin-4-yl]amino]-5-methylselenophene-2-carboxylate |
|---|---|
| PubChem CID | 140618612 |
| Molecular Formula | C18H19N3O4Se |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | methyl 4-[[6,7-bis(hydroxymethyl)-2-methylquinazolin-4-yl]amino]-5-methylselenophene-2-carboxylate |
| SMILES | COC(=O)c1cc(Nc2nc(C)nc3cc(CO)c(CO)cc23)c(C)[se]1 |
| InChI | InChI=1S/C18H19N3O4Se/c1-9-14(6-16(26-9)18(24)25-3)21-17-13-4-11(7-22)12(8-23)5-15(13)19-10(2)20-17/h4-6,22-23H,7-8H2,1-3H3,(H,19,20,21) |
| InChIKey | NABIKZLJAQZBFV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|