C29H27N5O — CID 140626596
1-[[4-(4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]methyl]piperidine-4-carbaldehyde (PubChem CID 140626596) has the molecular formula C29H27N5O and a molecular weight of 461.57 g/mol. Its IUPAC name is 1-[[4-(4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]methyl]piperidine-4-carbaldehyde.
| Compound Name | 1-[[4-(4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]methyl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 140626596 |
| Molecular Formula | C29H27N5O |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 1-[[4-(4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]methyl]piperidine-4-carbaldehyde |
| SMILES | Cc1cc2ncc3cc(-c4ccccc4)c(-c4ccc(CN5CCC(C=O)CC5)cc4)nc3n2n1 |
| InChI | InChI=1S/C29H27N5O/c1-20-15-27-30-17-25-16-26(23-5-3-2-4-6-23)28(31-29(25)34(27)32-20)24-9-7-21(8-10-24)18-33-13-11-22(19-35)12-14-33/h2-10,15-17,19,22H,11-14,18H2,1H3 |
| InChIKey | RSIBKPWFRKXQQZ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|