C35H32N6O — CID 46941126
N-[1-[[4-(4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]methyl]piperidin-4-yl]benzamide (PubChem CID 46941126) has the molecular formula C35H32N6O and a molecular weight of 552.68 g/mol. Its IUPAC name is N-[1-[[4-(4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]methyl]piperidin-4-yl]benzamide.
| Compound Name | N-[1-[[4-(4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 46941126 |
| Molecular Formula | C35H32N6O |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | N-[1-[[4-(4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]methyl]piperidin-4-yl]benzamide |
| SMILES | Cc1cc2ncc3cc(-c4ccccc4)c(-c4ccc(CN5CCC(NC(=O)c6ccccc6)CC5)cc4)nc3n2n1 |
| InChI | InChI=1S/C35H32N6O/c1-24-20-32-36-22-29-21-31(26-8-4-2-5-9-26)33(38-34(29)41(32)39-24)27-14-12-25(13-15-27)23-40-18-16-30(17-19-40)37-35(42)28-10-6-3-7-11-28/h2-15,20-22,30H,16-19,23H2,1H3,(H,37,42) |
| InChIKey | DHHWDQAXKLSSGE-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |