C29H26N5O2+ — CID 91352811
1-[[4-(4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]methyl]-2,3,4,5-tetrahydropyridin-1-ium-4-carboxylic acid (PubChem CID 91352811) has the molecular formula C29H26N5O2+ and a molecular weight of 476.56 g/mol. Its IUPAC name is 1-[[4-(4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]methyl]-2,3,4,5-tetrahydropyridin-1-ium-4-carboxylic acid.
| Compound Name | 1-[[4-(4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]methyl]-2,3,4,5-tetrahydropyridin-1-ium-4-carboxylic acid |
|---|---|
| PubChem CID | 91352811 |
| Molecular Formula | C29H26N5O2+ |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 1-[[4-(4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]methyl]-2,3,4,5-tetrahydropyridin-1-ium-4-carboxylic acid |
| SMILES | Cc1cc2ncc3cc(-c4ccccc4)c(-c4ccc(C[N+]5=CCC(C(=O)O)CC5)cc4)nc3n2n1 |
| InChI | InChI=1S/C29H25N5O2/c1-19-15-26-30-17-24-16-25(21-5-3-2-4-6-21)27(31-28(24)34(26)32-19)22-9-7-20(8-10-22)18-33-13-11-23(12-14-33)29(35)36/h2-10,13,15-17,23H,11-12,14,18H2,1H3/p+1 |
| InChIKey | YQGJKCJWIPELCC-UHFFFAOYSA-O |
| XLogP | 5.00 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|