C35H27N5O3 — CID 66629090
2-[3-methoxy-1-[4-(4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]cyclobutyl]isoindole-1,3-dione (PubChem CID 66629090) has the molecular formula C35H27N5O3 and a molecular weight of 565.63 g/mol. Its IUPAC name is 2-[3-methoxy-1-[4-(4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]cyclobutyl]isoindole-1,3-dione.
| Compound Name | 2-[3-methoxy-1-[4-(4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]cyclobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 66629090 |
| Molecular Formula | C35H27N5O3 |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.21 |
| IUPAC Name | 2-[3-methoxy-1-[4-(4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]cyclobutyl]isoindole-1,3-dione |
| SMILES | COC1CC(c2ccc(-c3nc4c(cnc5cc(C)nn54)cc3-c3ccccc3)cc2)(N2C(=O)c3ccccc3C2=O)C1 |
| InChI | InChI=1S/C35H27N5O3/c1-21-16-30-36-20-24-17-29(22-8-4-3-5-9-22)31(37-32(24)40(30)38-21)23-12-14-25(15-13-23)35(18-26(19-35)43-2)39-33(41)27-10-6-7-11-28(27)34(39)42/h3-17,20,26H,18-19H2,1-2H3 |
| InChIKey | JBDRBUIVKFERHR-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 89.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|