C37H31N5O3 — CID 58034709
2-[3-hydroxy-1-[4-(4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]-3-propan-2-ylcyclobutyl]isoindole-1,3-dione (PubChem CID 58034709) has the molecular formula C37H31N5O3 and a molecular weight of 593.69 g/mol. Its IUPAC name is 2-[3-hydroxy-1-[4-(4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]-3-propan-2-ylcyclobutyl]isoindole-1,3-dione.
| Compound Name | 2-[3-hydroxy-1-[4-(4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]-3-propan-2-ylcyclobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58034709 |
| Molecular Formula | C37H31N5O3 |
| Molecular Weight | 593.69 g/mol |
| Exact Mass | 593.24 |
| IUPAC Name | 2-[3-hydroxy-1-[4-(4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]-3-propan-2-ylcyclobutyl]isoindole-1,3-dione |
| SMILES | Cc1cc2ncc3cc(-c4ccccc4)c(-c4ccc(C5(N6C(=O)c7ccccc7C6=O)CC(O)(C(C)C)C5)cc4)nc3n2n1 |
| InChI | InChI=1S/C37H31N5O3/c1-22(2)37(45)20-36(21-37,41-34(43)28-11-7-8-12-29(28)35(41)44)27-15-13-25(14-16-27)32-30(24-9-5-4-6-10-24)18-26-19-38-31-17-23(3)40-42(31)33(26)39-32/h4-19,22,45H,20-21H2,1-3H3 |
| InChIKey | VSZJCXDWSCLDJZ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 100.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.69 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|