C38H33N5O3 — CID 58034524
2-[1-[4-(4-tert-butyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]-3-hydroxy-3-methylcyclobutyl]isoindole-1,3-dione (PubChem CID 58034524) has the molecular formula C38H33N5O3 and a molecular weight of 607.71 g/mol. Its IUPAC name is 2-[1-[4-(4-tert-butyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]-3-hydroxy-3-methylcyclobutyl]isoindole-1,3-dione.
| Compound Name | 2-[1-[4-(4-tert-butyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]-3-hydroxy-3-methylcyclobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58034524 |
| Molecular Formula | C38H33N5O3 |
| Molecular Weight | 607.71 g/mol |
| Exact Mass | 607.26 |
| IUPAC Name | 2-[1-[4-(4-tert-butyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]-3-hydroxy-3-methylcyclobutyl]isoindole-1,3-dione |
| SMILES | CC1(O)CC(c2ccc(-c3nc4c(cnc5cc(C(C)(C)C)nn54)cc3-c3ccccc3)cc2)(N2C(=O)c3ccccc3C2=O)C1 |
| InChI | InChI=1S/C38H33N5O3/c1-36(2,3)30-19-31-39-20-25-18-29(23-10-6-5-7-11-23)32(40-33(25)43(31)41-30)24-14-16-26(17-15-24)38(21-37(4,46)22-38)42-34(44)27-12-8-9-13-28(27)35(42)45/h5-20,46H,21-22H2,1-4H3 |
| InChIKey | UCGPDDCKQMILGS-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 100.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.71 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|