C27H35N3O3 — CID 140632385
1-[[(2S)-2-amino-3-methylbutanoyl]amino]-N-[2-[4-(4-phenylbutyl)phenyl]acetyl]cyclopropane-1-carboxamide (PubChem CID 140632385) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is 1-[[(2S)-2-amino-3-methylbutanoyl]amino]-N-[2-[4-(4-phenylbutyl)phenyl]acetyl]cyclopropane-1-carboxamide.
| Compound Name | 1-[[(2S)-2-amino-3-methylbutanoyl]amino]-N-[2-[4-(4-phenylbutyl)phenyl]acetyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 140632385 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | 1-[[(2S)-2-amino-3-methylbutanoyl]amino]-N-[2-[4-(4-phenylbutyl)phenyl]acetyl]cyclopropane-1-carboxamide |
| SMILES | CC(C)[C@H](N)C(=O)NC1(C(=O)NC(=O)Cc2ccc(CCCCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C27H35N3O3/c1-19(2)24(28)25(32)30-27(16-17-27)26(33)29-23(31)18-22-14-12-21(13-15-22)11-7-6-10-20-8-4-3-5-9-20/h3-5,8-9,12-15,19,24H,6-7,10-11,16-18,28H2,1-2H3,(H,30,32)(H,29,31,33)/t24-/m0/s1 |
| InChIKey | PTNIGUTVOCFBEZ-DEOSSOPVSA-N |
| XLogP | 3.07 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|