C31H35N3O4 — CID 59745029
[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 1-[[(2S)-2-amino-3-phenylpropanoyl]amino]cyclopropane-1-carboxylate (PubChem CID 59745029) has the molecular formula C31H35N3O4 and a molecular weight of 513.64 g/mol. Its IUPAC name is [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 1-[[(2S)-2-amino-3-phenylpropanoyl]amino]cyclopropane-1-carboxylate.
| Compound Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 1-[[(2S)-2-amino-3-phenylpropanoyl]amino]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 59745029 |
| Molecular Formula | C31H35N3O4 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 1-[[(2S)-2-amino-3-phenylpropanoyl]amino]cyclopropane-1-carboxylate |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)NC1(C(=O)ONC(=O)Cc2ccc(CCCCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C31H35N3O4/c32-27(21-25-13-5-2-6-14-25)29(36)33-31(19-20-31)30(37)38-34-28(35)22-26-17-15-24(16-18-26)12-8-7-11-23-9-3-1-4-10-23/h1-6,9-10,13-18,27H,7-8,11-12,19-22,32H2,(H,33,36)(H,34,35)/t27-/m0/s1 |
| InChIKey | PRKIQILTPBTXDR-MHZLTWQESA-N |
| XLogP | 3.59 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|