C28H26F6N2O6 — CID 140633365
ethyl (2S)-2-[[hydroxy-[2-phenyl-1,1-bis[3-(trifluoromethoxy)phenyl]ethyl]carbamoyl]amino]propanoate (PubChem CID 140633365) has the molecular formula C28H26F6N2O6 and a molecular weight of 600.51 g/mol. Its IUPAC name is ethyl (2S)-2-[[hydroxy-[2-phenyl-1,1-bis[3-(trifluoromethoxy)phenyl]ethyl]carbamoyl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[hydroxy-[2-phenyl-1,1-bis[3-(trifluoromethoxy)phenyl]ethyl]carbamoyl]amino]propanoate |
|---|---|
| PubChem CID | 140633365 |
| Molecular Formula | C28H26F6N2O6 |
| Molecular Weight | 600.51 g/mol |
| Exact Mass | 600.17 |
| IUPAC Name | ethyl (2S)-2-[[hydroxy-[2-phenyl-1,1-bis[3-(trifluoromethoxy)phenyl]ethyl]carbamoyl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NC(=O)N(O)C(Cc1ccccc1)(c1cccc(OC(F)(F)F)c1)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C28H26F6N2O6/c1-3-40-24(37)18(2)35-25(38)36(39)26(17-19-9-5-4-6-10-19,20-11-7-13-22(15-20)41-27(29,30)31)21-12-8-14-23(16-21)42-28(32,33)34/h4-16,18,39H,3,17H2,1-2H3,(H,35,38)/t18-/m0/s1 |
| InChIKey | CDPQZDWOCVEGHM-SFHVURJKSA-N |
| XLogP | 6.32 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.51 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|