C18H20N2O+2 — CID 140633643
2-(piperazine-1,4-diium-1-ylmethyl)phenalen-1-one (PubChem CID 140633643) has the molecular formula C18H20N2O+2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-(piperazine-1,4-diium-1-ylmethyl)phenalen-1-one.
| Compound Name | 2-(piperazine-1,4-diium-1-ylmethyl)phenalen-1-one |
|---|---|
| PubChem CID | 140633643 |
| Molecular Formula | C18H20N2O+2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-(piperazine-1,4-diium-1-ylmethyl)phenalen-1-one |
| SMILES | O=C1C(C[NH+]2CC[NH2+]CC2)=Cc2cccc3cccc1c23 |
| InChI | InChI=1S/C18H18N2O/c21-18-15(12-20-9-7-19-8-10-20)11-14-5-1-3-13-4-2-6-16(18)17(13)14/h1-6,11,19H,7-10,12H2/p+2 |
| InChIKey | GALPXTLJWMRFRK-UHFFFAOYSA-P |
| XLogP | -0.12 |
| TPSA | 38.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |