C26H30O4 — CID 142428073
2-[2,2-bis(prop-2-enoxymethyl)butoxymethyl]phenalen-1-one (PubChem CID 142428073) has the molecular formula C26H30O4 and a molecular weight of 406.52 g/mol. Its IUPAC name is 2-[2,2-bis(prop-2-enoxymethyl)butoxymethyl]phenalen-1-one.
| Compound Name | 2-[2,2-bis(prop-2-enoxymethyl)butoxymethyl]phenalen-1-one |
|---|---|
| PubChem CID | 142428073 |
| Molecular Formula | C26H30O4 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 2-[2,2-bis(prop-2-enoxymethyl)butoxymethyl]phenalen-1-one |
| SMILES | C=CCOCC(CC)(COCC=C)COCC1=Cc2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C26H30O4/c1-4-13-28-17-26(6-3,18-29-14-5-2)19-30-16-22-15-21-11-7-9-20-10-8-12-23(24(20)21)25(22)27/h4-5,7-12,15H,1-2,6,13-14,16-19H2,3H3 |
| InChIKey | STNWZOACIJNUNN-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|