C25H32NO2+ — CID 142428134
dimethyl-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-[(1-oxophenalen-2-yl)methyl]azanium;ethane (PubChem CID 142428134) has the molecular formula C25H32NO2+ and a molecular weight of 378.54 g/mol. Its IUPAC name is dimethyl-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-[(1-oxophenalen-2-yl)methyl]azanium;ethane.
| Compound Name | dimethyl-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-[(1-oxophenalen-2-yl)methyl]azanium;ethane |
|---|---|
| PubChem CID | 142428134 |
| Molecular Formula | C25H32NO2+ |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | dimethyl-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-[(1-oxophenalen-2-yl)methyl]azanium;ethane |
| SMILES | C=C(C)C(=C)OCC[N+](C)(C)CC1=Cc2cccc3cccc(c23)C1=O.CC |
| InChI | InChI=1S/C23H26NO2.C2H6/c1-16(2)17(3)26-13-12-24(4,5)15-20-14-19-10-6-8-18-9-7-11-21(22(18)19)23(20)25;1-2/h6-11,14H,1,3,12-13,15H2,2,4-5H3;1-2H3/q+1; |
| InChIKey | IRERRXDSWAWQRT-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|