C22H25ClN2O2 — CID 159355674
dimethyl-[2-(2-methylprop-2-enoylamino)ethyl]-[(1-oxophenalen-2-yl)methyl]azanium chloride (PubChem CID 159355674) has the molecular formula C22H25ClN2O2 and a molecular weight of 384.91 g/mol. Its IUPAC name is dimethyl-[2-(2-methylprop-2-enoylamino)ethyl]-[(1-oxophenalen-2-yl)methyl]azanium chloride.
| Compound Name | dimethyl-[2-(2-methylprop-2-enoylamino)ethyl]-[(1-oxophenalen-2-yl)methyl]azanium chloride |
|---|---|
| PubChem CID | 159355674 |
| Molecular Formula | C22H25ClN2O2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | dimethyl-[2-(2-methylprop-2-enoylamino)ethyl]-[(1-oxophenalen-2-yl)methyl]azanium chloride |
| SMILES | C=C(C)C(=O)NCC[N+](C)(C)CC1=Cc2cccc3cccc(c23)C1=O.[Cl-] |
| InChI | InChI=1S/C22H24N2O2.ClH/c1-15(2)22(26)23-11-12-24(3,4)14-18-13-17-9-5-7-16-8-6-10-19(20(16)17)21(18)25;/h5-10,13H,1,11-12,14H2,2-4H3;1H |
| InChIKey | CFGLMNZFADZBRO-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|