C21H26ClNO — CID 169427324
methyl-[(1-oxophenalen-2-yl)methyl]-dipropylazanium chloride (PubChem CID 169427324) has the molecular formula C21H26ClNO and a molecular weight of 343.90 g/mol. Its IUPAC name is methyl-[(1-oxophenalen-2-yl)methyl]-dipropylazanium chloride.
| Compound Name | methyl-[(1-oxophenalen-2-yl)methyl]-dipropylazanium chloride |
|---|---|
| PubChem CID | 169427324 |
| Molecular Formula | C21H26ClNO |
| Molecular Weight | 343.90 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | methyl-[(1-oxophenalen-2-yl)methyl]-dipropylazanium chloride |
| SMILES | CCC[N+](C)(CCC)CC1=Cc2cccc3cccc(c23)C1=O.[Cl-] |
| InChI | InChI=1S/C21H26NO.ClH/c1-4-12-22(3,13-5-2)15-18-14-17-10-6-8-16-9-7-11-19(20(16)17)21(18)23;/h6-11,14H,4-5,12-13,15H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | UEBFJCNOWYJHDE-UHFFFAOYSA-M |
| XLogP | 1.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.90 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|