About chloromethane;2-[[4-(hydroxymethyl)pyridin-1-ium-1-yl]methyl]phenalen-1-one
chloromethane;2-[[4-(hydroxymethyl)pyridin-1-ium-1-yl]methyl]phenalen-1-one (PubChem CID 142428100) has the molecular formula C21H19ClNO2+
and a molecular weight of 352.84 g/mol. Its IUPAC name is chloromethane;2-[[4-(hydroxymethyl)pyridin-1-ium-1-yl]methyl]phenalen-1-one.
Molecular Properties
| Compound Name | chloromethane;2-[[4-(hydroxymethyl)pyridin-1-ium-1-yl]methyl]phenalen-1-one |
| PubChem CID | 142428100 |
| Molecular Formula | C21H19ClNO2+ |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | chloromethane;2-[[4-(hydroxymethyl)pyridin-1-ium-1-yl]methyl]phenalen-1-one |
| SMILES | CCl.O=C1C(C[n+]2ccc(CO)cc2)=Cc2cccc3cccc1c23 |
| InChI | InChI=1S/C20H16NO2.CH3Cl/c22-13-14-7-9-21(10-8-14)12-17-11-16-5-1-3-15-4-2-6-18(19(15)16)20(17)23;1-2/h1-11,22H,12-13H2;1H3/q+1; |
| InChIKey | ASGGXYLBNBAIBN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 41.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;2-[[4-(hydroxymethyl)pyridin-1-ium-1-yl]methyl]phenalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;2-[[4-(hydroxymethyl)pyridin-1-ium-1-yl]methyl]phenalen-1-one?
The IUPAC name of chloromethane;2-[[4-(hydroxymethyl)pyridin-1-ium-1-yl]methyl]phenalen-1-one (CID 142428100) is chloromethane;2-[[4-(hydroxymethyl)pyridin-1-ium-1-yl]methyl]phenalen-1-one.
What is the SMILES notation for chloromethane;2-[[4-(hydroxymethyl)pyridin-1-ium-1-yl]methyl]phenalen-1-one?
The canonical SMILES for chloromethane;2-[[4-(hydroxymethyl)pyridin-1-ium-1-yl]methyl]phenalen-1-one is CCl.O=C1C(C[n+]2ccc(CO)cc2)=Cc2cccc3cccc1c23.
What is the InChIKey of chloromethane;2-[[4-(hydroxymethyl)pyridin-1-ium-1-yl]methyl]phenalen-1-one?
The InChIKey is ASGGXYLBNBAIBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16NO2.CH3Cl/c22-13-14-7-9-21(10-8-14)12-17-11-16-5-1-3-15-4-2-6-18(19(15)16)20(17)23;1-2/h1-11,22H,12-13H2;1H3/q+1;.
What are the key properties of chloromethane;2-[[4-(hydroxymethyl)pyridin-1-ium-1-yl]methyl]phenalen-1-one?
chloromethane;2-[[4-(hydroxymethyl)pyridin-1-ium-1-yl]methyl]phenalen-1-one has a molecular weight of 352.84 g/mol, XLogP of 3.75, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;2-[[4-(hydroxymethyl)pyridin-1-ium-1-yl]methyl]phenalen-1-one is sourced from PubChem (CID 142428100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).