C9H15N2O3S+ — CID 70047438
N-[2-[4-(hydroxymethyl)pyridin-1-ium-1-yl]ethyl]methanesulfonamide (PubChem CID 70047438) has the molecular formula C9H15N2O3S+ and a molecular weight of 231.30 g/mol. Its IUPAC name is N-[2-[4-(hydroxymethyl)pyridin-1-ium-1-yl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[4-(hydroxymethyl)pyridin-1-ium-1-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 70047438 |
| Molecular Formula | C9H15N2O3S+ |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | N-[2-[4-(hydroxymethyl)pyridin-1-ium-1-yl]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCC[n+]1ccc(CO)cc1 |
| InChI | InChI=1S/C9H15N2O3S/c1-15(13,14)10-4-7-11-5-2-9(8-12)3-6-11/h2-3,5-6,10,12H,4,7-8H2,1H3/q+1 |
| InChIKey | KACNLUBXRDCDGQ-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 70.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|