C20H17N5O2S — CID 140634330
N-[2-cyano-4-[2-(4-methoxyanilino)pyrimidin-4-yl]sulfanylphenyl]acetamide (PubChem CID 140634330) has the molecular formula C20H17N5O2S and a molecular weight of 391.46 g/mol. Its IUPAC name is N-[2-cyano-4-[2-(4-methoxyanilino)pyrimidin-4-yl]sulfanylphenyl]acetamide.
| Compound Name | N-[2-cyano-4-[2-(4-methoxyanilino)pyrimidin-4-yl]sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 140634330 |
| Molecular Formula | C20H17N5O2S |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | N-[2-cyano-4-[2-(4-methoxyanilino)pyrimidin-4-yl]sulfanylphenyl]acetamide |
| SMILES | COc1ccc(Nc2nccc(Sc3ccc(NC(C)=O)c(C#N)c3)n2)cc1 |
| InChI | InChI=1S/C20H17N5O2S/c1-13(26)23-18-8-7-17(11-14(18)12-21)28-19-9-10-22-20(25-19)24-15-3-5-16(27-2)6-4-15/h3-11H,1-2H3,(H,23,26)(H,22,24,25) |
| InChIKey | JCCRREKSNGRNSQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |