C28H22O4 — CID 140639868
1,2-dinaphthalen-1-yloctane-1,4,5,7-tetrone (PubChem CID 140639868) has the molecular formula C28H22O4 and a molecular weight of 422.48 g/mol. Its IUPAC name is 1,2-dinaphthalen-1-yloctane-1,4,5,7-tetrone.
| Compound Name | 1,2-dinaphthalen-1-yloctane-1,4,5,7-tetrone |
|---|---|
| PubChem CID | 140639868 |
| Molecular Formula | C28H22O4 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 1,2-dinaphthalen-1-yloctane-1,4,5,7-tetrone |
| SMILES | CC(=O)CC(=O)C(=O)CC(C(=O)c1cccc2ccccc12)c1cccc2ccccc12 |
| InChI | InChI=1S/C28H22O4/c1-18(29)16-26(30)27(31)17-25(23-14-6-10-19-8-2-4-12-21(19)23)28(32)24-15-7-11-20-9-3-5-13-22(20)24/h2-15,25H,16-17H2,1H3 |
| InChIKey | VLHIKLRYUKSCBE-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|