C28H24O3 — CID 140640194
1,3-dinaphthalen-1-yloctane-1,2,7-trione (PubChem CID 140640194) has the molecular formula C28H24O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 1,3-dinaphthalen-1-yloctane-1,2,7-trione.
| Compound Name | 1,3-dinaphthalen-1-yloctane-1,2,7-trione |
|---|---|
| PubChem CID | 140640194 |
| Molecular Formula | C28H24O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 1,3-dinaphthalen-1-yloctane-1,2,7-trione |
| SMILES | CC(=O)CCCC(C(=O)C(=O)c1cccc2ccccc12)c1cccc2ccccc12 |
| InChI | InChI=1S/C28H24O3/c1-19(29)9-6-17-26(24-16-7-12-20-10-2-4-14-22(20)24)28(31)27(30)25-18-8-13-21-11-3-5-15-23(21)25/h2-5,7-8,10-16,18,26H,6,9,17H2,1H3 |
| InChIKey | KFJYPABYZOWPJO-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|