C26H20O3 — CID 140639979
1,3-dinaphthalen-1-ylhexane-1,2,4-trione (PubChem CID 140639979) has the molecular formula C26H20O3 and a molecular weight of 380.44 g/mol. Its IUPAC name is 1,3-dinaphthalen-1-ylhexane-1,2,4-trione.
| Compound Name | 1,3-dinaphthalen-1-ylhexane-1,2,4-trione |
|---|---|
| PubChem CID | 140639979 |
| Molecular Formula | C26H20O3 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 1,3-dinaphthalen-1-ylhexane-1,2,4-trione |
| SMILES | CCC(=O)C(C(=O)C(=O)c1cccc2ccccc12)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H20O3/c1-2-23(27)24(21-15-7-11-17-9-3-5-13-19(17)21)26(29)25(28)22-16-8-12-18-10-4-6-14-20(18)22/h3-16,24H,2H2,1H3 |
| InChIKey | WSQWVZPMTWROFN-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|