C28H24O3 — CID 140640405
1,2-dinaphthalen-1-yloctane-1,4,5-trione (PubChem CID 140640405) has the molecular formula C28H24O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 1,2-dinaphthalen-1-yloctane-1,4,5-trione.
| Compound Name | 1,2-dinaphthalen-1-yloctane-1,4,5-trione |
|---|---|
| PubChem CID | 140640405 |
| Molecular Formula | C28H24O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 1,2-dinaphthalen-1-yloctane-1,4,5-trione |
| SMILES | CCCC(=O)C(=O)CC(C(=O)c1cccc2ccccc12)c1cccc2ccccc12 |
| InChI | InChI=1S/C28H24O3/c1-2-9-26(29)27(30)18-25(23-16-7-12-19-10-3-5-14-21(19)23)28(31)24-17-8-13-20-11-4-6-15-22(20)24/h3-8,10-17,25H,2,9,18H2,1H3 |
| InChIKey | CUWUFKBNXQJRGF-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|