C27H22O3 — CID 140640389
1,2-dinaphthalen-1-ylheptane-1,5,6-trione (PubChem CID 140640389) has the molecular formula C27H22O3 and a molecular weight of 394.47 g/mol. Its IUPAC name is 1,2-dinaphthalen-1-ylheptane-1,5,6-trione.
| Compound Name | 1,2-dinaphthalen-1-ylheptane-1,5,6-trione |
|---|---|
| PubChem CID | 140640389 |
| Molecular Formula | C27H22O3 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 1,2-dinaphthalen-1-ylheptane-1,5,6-trione |
| SMILES | CC(=O)C(=O)CCC(C(=O)c1cccc2ccccc12)c1cccc2ccccc12 |
| InChI | InChI=1S/C27H22O3/c1-18(28)26(29)17-16-25(23-14-6-10-19-8-2-4-12-21(19)23)27(30)24-15-7-11-20-9-3-5-13-22(20)24/h2-15,25H,16-17H2,1H3 |
| InChIKey | RXJSILQWTHLRNL-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|